C23H28N8O3S — CID 89419462
N-[(3E,5Z)-6-amino-3-[6-(4-morpholin-4-ylanilino)-7H-purin-8-yl]hexa-1,3,5-trien-2-yl]-N-methylmethanesulfonamide (PubChem CID 89419462) has the molecular formula C23H28N8O3S and a molecular weight of 496.60 g/mol. Its IUPAC name is N-[(3E,5Z)-6-amino-3-[6-(4-morpholin-4-ylanilino)-7H-purin-8-yl]hexa-1,3,5-trien-2-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[(3E,5Z)-6-amino-3-[6-(4-morpholin-4-ylanilino)-7H-purin-8-yl]hexa-1,3,5-trien-2-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 89419462 |
| Molecular Formula | C23H28N8O3S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[(3E,5Z)-6-amino-3-[6-(4-morpholin-4-ylanilino)-7H-purin-8-yl]hexa-1,3,5-trien-2-yl]-N-methylmethanesulfonamide |
| SMILES | C=C(/C(=C\C=C/N)c1nc2ncnc(Nc3ccc(N4CCOCC4)cc3)c2[nH]1)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C23H28N8O3S/c1-16(30(2)35(3,32)33)19(5-4-10-24)21-28-20-22(25-15-26-23(20)29-21)27-17-6-8-18(9-7-17)31-11-13-34-14-12-31/h4-10,15H,1,11-14,24H2,2-3H3,(H2,25,26,27,28,29)/b10-4-,19-5+ |
| InChIKey | SQAOBQWPRVBENI-GENQMPGTSA-N |
| XLogP | 2.19 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|