C21H26N4O — CID 143267063
ethane;6-methyl-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine (PubChem CID 143267063) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is ethane;6-methyl-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine.
| Compound Name | ethane;6-methyl-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 143267063 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethane;6-methyl-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
| SMILES | CC.Cc1ccc2ncnc(Nc3ccc(N4CCOCC4)cc3)c2c1 |
| InChI | InChI=1S/C19H20N4O.C2H6/c1-14-2-7-18-17(12-14)19(21-13-20-18)22-15-3-5-16(6-4-15)23-8-10-24-11-9-23;1-2/h2-7,12-13H,8-11H2,1H3,(H,20,21,22);1-2H3 |
| InChIKey | IKMJCUMZCLTDMR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|