C30H31N7O — CID 68878121
6-[4-(diethylamino)quinazolin-6-yl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine (PubChem CID 68878121) has the molecular formula C30H31N7O and a molecular weight of 505.63 g/mol. Its IUPAC name is 6-[4-(diethylamino)quinazolin-6-yl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine.
| Compound Name | 6-[4-(diethylamino)quinazolin-6-yl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 68878121 |
| Molecular Formula | C30H31N7O |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 6-[4-(diethylamino)quinazolin-6-yl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
| SMILES | CCN(CC)c1ncnc2ccc(-c3ccc4ncnc(Nc5ccc(N6CCOCC6)cc5)c4c3)cc12 |
| InChI | InChI=1S/C30H31N7O/c1-3-36(4-2)30-26-18-22(6-12-28(26)32-20-34-30)21-5-11-27-25(17-21)29(33-19-31-27)35-23-7-9-24(10-8-23)37-13-15-38-16-14-37/h5-12,17-20H,3-4,13-16H2,1-2H3,(H,31,33,35) |
| InChIKey | SJSZKTSZCJEDKD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|