C30H32FN5O3 — CID 69177666
6-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine (PubChem CID 69177666) has the molecular formula C30H32FN5O3 and a molecular weight of 529.62 g/mol. Its IUPAC name is 6-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine.
| Compound Name | 6-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 69177666 |
| Molecular Formula | C30H32FN5O3 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 6-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
| SMILES | Fc1cc(-c2ccc3ncnc(Nc4ccc(N5CCOCC5)cc4)c3c2)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C30H32FN5O3/c31-27-20-23(2-8-29(27)39-18-11-35-9-14-37-15-10-35)22-1-7-28-26(19-22)30(33-21-32-28)34-24-3-5-25(6-4-24)36-12-16-38-17-13-36/h1-8,19-21H,9-18H2,(H,32,33,34) |
| InChIKey | VTLFUINJIRUEMI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|