C18H23N7O3S — CID 59591810
4-N-ethyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 59591810) has the molecular formula C18H23N7O3S and a molecular weight of 417.50 g/mol. Its IUPAC name is 4-N-ethyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 59591810 |
| Molecular Formula | C18H23N7O3S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-N-ethyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CCNc1nc(Nc2ccc(N3CCOCC3)cc2)nc2n[nH]c(S(C)(=O)=O)c12 |
| InChI | InChI=1S/C18H23N7O3S/c1-3-19-15-14-16(23-24-17(14)29(2,26)27)22-18(21-15)20-12-4-6-13(7-5-12)25-8-10-28-11-9-25/h4-7H,3,8-11H2,1-2H3,(H3,19,20,21,22,23,24) |
| InChIKey | OKTVZESRIFIOHI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|