C19H20N8OS2 — CID 59591742
3-methylsulfanyl-6-N-(4-morpholin-4-ylphenyl)-4-N-(1,3-thiazol-2-yl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine (PubChem CID 59591742) has the molecular formula C19H20N8OS2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 3-methylsulfanyl-6-N-(4-morpholin-4-ylphenyl)-4-N-(1,3-thiazol-2-yl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 3-methylsulfanyl-6-N-(4-morpholin-4-ylphenyl)-4-N-(1,3-thiazol-2-yl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 59591742 |
| Molecular Formula | C19H20N8OS2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-methylsulfanyl-6-N-(4-morpholin-4-ylphenyl)-4-N-(1,3-thiazol-2-yl)-1H-pyrazolo[5,4-d]pyrimidine-4,6-diamine |
| SMILES | CSc1n[nH]c2nc(Nc3ccc(N4CCOCC4)cc3)nc(Nc3nccs3)c12 |
| InChI | InChI=1S/C19H20N8OS2/c1-29-17-14-15(24-19-20-6-11-30-19)22-18(23-16(14)25-26-17)21-12-2-4-13(5-3-12)27-7-9-28-10-8-27/h2-6,11H,7-10H2,1H3,(H3,20,21,22,23,24,25,26) |
| InChIKey | BNOWHINMMOQICO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|