C20H26N8O4S — CID 59591749
4-[[3-methylsulfonyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]amino]butanamide (PubChem CID 59591749) has the molecular formula C20H26N8O4S and a molecular weight of 474.55 g/mol. Its IUPAC name is 4-[[3-methylsulfonyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]amino]butanamide.
| Compound Name | 4-[[3-methylsulfonyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]amino]butanamide |
|---|---|
| PubChem CID | 59591749 |
| Molecular Formula | C20H26N8O4S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[[3-methylsulfonyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]amino]butanamide |
| SMILES | CS(=O)(=O)c1[nH]nc2nc(Nc3ccc(N4CCOCC4)cc3)nc(NCCCC(N)=O)c12 |
| InChI | InChI=1S/C20H26N8O4S/c1-33(30,31)19-16-17(22-8-2-3-15(21)29)24-20(25-18(16)26-27-19)23-13-4-6-14(7-5-13)28-9-11-32-12-10-28/h4-7H,2-3,8-12H2,1H3,(H2,21,29)(H3,22,23,24,25,26,27) |
| InChIKey | SQAXTBZORZPRCZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|