C19H23N7O3S — CID 68771386
1-cyclopropyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 68771386) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-cyclopropyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 1-cyclopropyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 68771386 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-cyclopropyl-3-methylsulfonyl-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1nn(C2CC2)c2nc(Nc3ccc(N4CCOCC4)cc3)nc(N)c12 |
| InChI | InChI=1S/C19H23N7O3S/c1-30(27,28)18-15-16(20)22-19(23-17(15)26(24-18)14-6-7-14)21-12-2-4-13(5-3-12)25-8-10-29-11-9-25/h2-5,14H,6-11H2,1H3,(H3,20,21,22,23) |
| InChIKey | QCGGZWOTVICOAW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|