C21H28N8O — CID 68774816
1-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 68774816) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 1-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 68774816 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCOCC3)cc2)nc2c1cnn2C1CCC(N)CC1 |
| InChI | InChI=1S/C21H28N8O/c22-14-1-5-17(6-2-14)29-20-18(13-24-29)19(23)26-21(27-20)25-15-3-7-16(8-4-15)28-9-11-30-12-10-28/h3-4,7-8,13-14,17H,1-2,5-6,9-12,22H2,(H3,23,25,26,27) |
| InChIKey | XXWJOTWEAPAIBQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|