C20H26N8O2S — CID 68771850
1-cyclopropyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-methylsulfonylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 68771850) has the molecular formula C20H26N8O2S and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-cyclopropyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-methylsulfonylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 1-cyclopropyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-methylsulfonylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 68771850 |
| Molecular Formula | C20H26N8O2S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-cyclopropyl-6-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-methylsulfonylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CN1CCN(c2ccc(Nc3nc(N)c4c(S(C)(=O)=O)nn(C5CC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C20H26N8O2S/c1-26-9-11-27(12-10-26)14-5-3-13(4-6-14)22-20-23-17(21)16-18(24-20)28(15-7-8-15)25-19(16)31(2,29)30/h3-6,15H,7-12H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | UBMPEBGNTFLZQF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|