C24H29ClN6 — CID 66637339
6-(4-chloro-3,5-dimethylphenyl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 66637339) has the molecular formula C24H29ClN6 and a molecular weight of 436.99 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylphenyl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(4-chloro-3,5-dimethylphenyl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66637339 |
| Molecular Formula | C24H29ClN6 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylphenyl)-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc(N)c2C)cc(C)c1Cl |
| InChI | InChI=1S/C24H29ClN6/c1-15-13-18(14-16(2)21(15)25)22-17(3)23(26)29-24(28-22)27-19-5-7-20(8-6-19)31-11-9-30(4)10-12-31/h5-8,13-14H,9-12H2,1-4H3,(H3,26,27,28,29) |
| InChIKey | JHOSEFLNPMDYEJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|