C23H21ClFN7 — CID 126600120
8-(5-chloro-2-fluorophenyl)-2-N-(4-piperazin-1-ylphenyl)pyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 126600120) has the molecular formula C23H21ClFN7 and a molecular weight of 449.92 g/mol. Its IUPAC name is 8-(5-chloro-2-fluorophenyl)-2-N-(4-piperazin-1-ylphenyl)pyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 8-(5-chloro-2-fluorophenyl)-2-N-(4-piperazin-1-ylphenyl)pyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 126600120 |
| Molecular Formula | C23H21ClFN7 |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 8-(5-chloro-2-fluorophenyl)-2-N-(4-piperazin-1-ylphenyl)pyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCNCC3)cc2)nc2c(-c3cc(Cl)ccc3F)nccc12 |
| InChI | InChI=1S/C23H21ClFN7/c24-14-1-6-19(25)18(13-14)20-21-17(7-8-28-20)22(26)31-23(30-21)29-15-2-4-16(5-3-15)32-11-9-27-10-12-32/h1-8,13,27H,9-12H2,(H3,26,29,30,31) |
| InChIKey | CMLCXGOAACBLIR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|