C25H24Cl2N6O2 — CID 90720494
4-(2,6-dichlorophenyl)-8-methoxy-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 90720494) has the molecular formula C25H24Cl2N6O2 and a molecular weight of 511.41 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-8-methoxy-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-(2,6-dichlorophenyl)-8-methoxy-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90720494 |
| Molecular Formula | C25H24Cl2N6O2 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-8-methoxy-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COn1c(=O)ccc2c(-c3c(Cl)cccc3Cl)nc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C25H24Cl2N6O2/c1-31-12-14-32(15-13-31)17-8-6-16(7-9-17)28-25-29-23(22-19(26)4-3-5-20(22)27)18-10-11-21(34)33(35-2)24(18)30-25/h3-11H,12-15H2,1-2H3,(H,28,29,30) |
| InChIKey | NKGDMNMUFJFHJU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|