C27H28ClFN6O2 — CID 90212910
7-(2-chloro-6-fluorophenyl)-9-ethoxy-2-[4-(4-methylpiperazin-1-yl)anilino]-5H-pyrimido[4,5-b]azepin-8-one (PubChem CID 90212910) has the molecular formula C27H28ClFN6O2 and a molecular weight of 523.01 g/mol. Its IUPAC name is 7-(2-chloro-6-fluorophenyl)-9-ethoxy-2-[4-(4-methylpiperazin-1-yl)anilino]-5H-pyrimido[4,5-b]azepin-8-one.
| Compound Name | 7-(2-chloro-6-fluorophenyl)-9-ethoxy-2-[4-(4-methylpiperazin-1-yl)anilino]-5H-pyrimido[4,5-b]azepin-8-one |
|---|---|
| PubChem CID | 90212910 |
| Molecular Formula | C27H28ClFN6O2 |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 7-(2-chloro-6-fluorophenyl)-9-ethoxy-2-[4-(4-methylpiperazin-1-yl)anilino]-5H-pyrimido[4,5-b]azepin-8-one |
| SMILES | CCON1C(=O)C(c2c(F)cccc2Cl)=CCc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H28ClFN6O2/c1-3-37-35-25-18(7-12-21(26(35)36)24-22(28)5-4-6-23(24)29)17-30-27(32-25)31-19-8-10-20(11-9-19)34-15-13-33(2)14-16-34/h4-6,8-12,17H,3,7,13-16H2,1-2H3,(H,30,31,32) |
| InChIKey | OJKATQBGCUHICL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|