C23H26N6OS — CID 68860717
[3-methyl-5-[2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]thiophen-2-yl]methanol (PubChem CID 68860717) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is [3-methyl-5-[2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]thiophen-2-yl]methanol.
| Compound Name | [3-methyl-5-[2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 68860717 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [3-methyl-5-[2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]thiophen-2-yl]methanol |
| SMILES | Cc1cc(-c2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc3[nH]ccc23)sc1CO |
| InChI | InChI=1S/C23H26N6OS/c1-15-13-19(31-20(15)14-30)21-18-7-8-24-22(18)27-23(26-21)25-16-3-5-17(6-4-16)29-11-9-28(2)10-12-29/h3-8,13,30H,9-12,14H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | IALSQZRHIRGSEG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|