C24H27N7S — CID 25262454
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 25262454) has the molecular formula C24H27N7S and a molecular weight of 445.60 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25262454 |
| Molecular Formula | C24H27N7S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(-c4cc5c(s4)CCNC5)c4cc[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H27N7S/c1-30-10-12-31(13-11-30)18-4-2-17(3-5-18)27-24-28-22(19-6-9-26-23(19)29-24)21-14-16-15-25-8-7-20(16)32-21/h2-6,9,14,25H,7-8,10-13,15H2,1H3,(H2,26,27,28,29) |
| InChIKey | FWEJGHXRKSEVRG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|