C27H32N8O — CID 67088253
8-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)-9-phenylpurine-2,6-diamine (PubChem CID 67088253) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is 8-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)-9-phenylpurine-2,6-diamine.
| Compound Name | 8-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)-9-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 67088253 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 8-(4-aminocyclohexyl)-6-N-(4-morpholin-4-ylphenyl)-9-phenylpurine-2,6-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCOCC3)cc2)c2nc(C3CCC(N)CC3)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C27H32N8O/c28-19-8-6-18(7-9-19)25-31-23-24(30-20-10-12-21(13-11-20)34-14-16-36-17-15-34)32-27(29)33-26(23)35(25)22-4-2-1-3-5-22/h1-5,10-13,18-19H,6-9,14-17,28H2,(H3,29,30,32,33) |
| InChIKey | JZUSEBOEVWAQRB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|