C22H23N7O3S2 — CID 89145726
4-[[7-(3-methyl-4-morpholin-4-ylanilino)-[1,3]thiazolo[4,5-d]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 89145726) has the molecular formula C22H23N7O3S2 and a molecular weight of 497.61 g/mol. Its IUPAC name is 4-[[7-(3-methyl-4-morpholin-4-ylanilino)-[1,3]thiazolo[4,5-d]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[7-(3-methyl-4-morpholin-4-ylanilino)-[1,3]thiazolo[4,5-d]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 89145726 |
| Molecular Formula | C22H23N7O3S2 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[[7-(3-methyl-4-morpholin-4-ylanilino)-[1,3]thiazolo[4,5-d]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Cc1cc(Nc2ncnc3nc(Nc4ccc(S(N)(=O)=O)cc4)sc23)ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H23N7O3S2/c1-14-12-16(4-7-18(14)29-8-10-32-11-9-29)26-20-19-21(25-13-24-20)28-22(33-19)27-15-2-5-17(6-3-15)34(23,30)31/h2-7,12-13H,8-11H2,1H3,(H2,23,30,31)(H2,24,25,26,27,28) |
| InChIKey | CMIBIHKAURXALM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|