C15H20N6O2 — CID 121410169
5-amino-3-(3-methyl-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide (PubChem CID 121410169) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 5-amino-3-(3-methyl-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(3-methyl-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121410169 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-amino-3-(3-methyl-4-morpholin-4-ylanilino)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(Nc2n[nH]c(N)c2C(N)=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H20N6O2/c1-9-8-10(2-3-11(9)21-4-6-23-7-5-21)18-15-12(14(17)22)13(16)19-20-15/h2-3,8H,4-7H2,1H3,(H2,17,22)(H4,16,18,19,20) |
| InChIKey | FDTCIECQFMQFMQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|