C23H26N6O3 — CID 68605505
3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide (PubChem CID 68605505) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide.
| Compound Name | 3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 68605505 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide |
| SMILES | Cc1c(C(N)=O)cccc1-c1cn(C)c(=O)c(Nc2ccc(N3CCOCC3)c(N)c2)n1 |
| InChI | InChI=1S/C23H26N6O3/c1-14-16(4-3-5-17(14)21(25)30)19-13-28(2)23(31)22(27-19)26-15-6-7-20(18(24)12-15)29-8-10-32-11-9-29/h3-7,12-13H,8-11,24H2,1-2H3,(H2,25,30)(H,26,27) |
| InChIKey | YHWYAUYROUQSFA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|