C32H37N7O3 — CID 58728943
N-[3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-5-tert-butylpyridine-2-carboxamide (PubChem CID 58728943) has the molecular formula C32H37N7O3 and a molecular weight of 567.69 g/mol. Its IUPAC name is N-[3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-5-tert-butylpyridine-2-carboxamide.
| Compound Name | N-[3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-5-tert-butylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 58728943 |
| Molecular Formula | C32H37N7O3 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | N-[3-[6-(3-amino-4-morpholin-4-ylanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-5-tert-butylpyridine-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccc(C(C)(C)C)cn2)cccc1-c1cn(C)c(=O)c(Nc2ccc(N3CCOCC3)c(N)c2)n1 |
| InChI | InChI=1S/C32H37N7O3/c1-20-23(7-6-8-25(20)37-30(40)26-11-9-21(18-34-26)32(2,3)4)27-19-38(5)31(41)29(36-27)35-22-10-12-28(24(33)17-22)39-13-15-42-16-14-39/h6-12,17-19H,13-16,33H2,1-5H3,(H,35,36)(H,37,40) |
| InChIKey | HINVZSDIVZMNAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|