C34H40N6O2 — CID 58729094
N-[3-[6-[4-(4-aminopiperidin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide (PubChem CID 58729094) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[3-[6-[4-(4-aminopiperidin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[6-[4-(4-aminopiperidin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 58729094 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | N-[3-[6-[4-(4-aminopiperidin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C(C)(C)C)cc2)cccc1-c1cn(C)c(=O)c(Nc2ccc(N3CCC(N)CC3)cc2)n1 |
| InChI | InChI=1S/C34H40N6O2/c1-22-28(7-6-8-29(22)38-32(41)23-9-11-24(12-10-23)34(2,3)4)30-21-39(5)33(42)31(37-30)36-26-13-15-27(16-14-26)40-19-17-25(35)18-20-40/h6-16,21,25H,17-20,35H2,1-5H3,(H,36,37)(H,38,41) |
| InChIKey | ULVBIRGREABSHG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|