C36H42N6O3 — CID 11852370
N-[3-[6-[4-(4-acetyl-1,4-diazepan-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide (PubChem CID 11852370) has the molecular formula C36H42N6O3 and a molecular weight of 606.77 g/mol. Its IUPAC name is N-[3-[6-[4-(4-acetyl-1,4-diazepan-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-[6-[4-(4-acetyl-1,4-diazepan-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 11852370 |
| Molecular Formula | C36H42N6O3 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | N-[3-[6-[4-(4-acetyl-1,4-diazepan-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4-tert-butylbenzamide |
| SMILES | CC(=O)N1CCCN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5ccc(C(C)(C)C)cc5)c4C)cn(C)c3=O)cc2)CC1 |
| InChI | InChI=1S/C36H42N6O3/c1-24-30(9-7-10-31(24)39-34(44)26-11-13-27(14-12-26)36(3,4)5)32-23-40(6)35(45)33(38-32)37-28-15-17-29(18-16-28)42-20-8-19-41(21-22-42)25(2)43/h7,9-18,23H,8,19-22H2,1-6H3,(H,37,38)(H,39,44) |
| InChIKey | CIBGHCGZPPFHTN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|