C35H42N6O2 — CID 66895894
4-tert-butyl-N-[3-[6-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide (PubChem CID 66895894) has the molecular formula C35H42N6O2 and a molecular weight of 578.76 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[6-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[6-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 66895894 |
| Molecular Formula | C35H42N6O2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 4-tert-butyl-N-[3-[6-[4-(4-ethylpiperazin-1-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5ccc(C(C)(C)C)cc5)c4C)cn(C)c3=O)cc2)CC1 |
| InChI | InChI=1S/C35H42N6O2/c1-7-40-19-21-41(22-20-40)28-17-15-27(16-18-28)36-32-34(43)39(6)23-31(37-32)29-9-8-10-30(24(29)2)38-33(42)25-11-13-26(14-12-25)35(3,4)5/h8-18,23H,7,19-22H2,1-6H3,(H,36,37)(H,38,42) |
| InChIKey | VEYJJOJKGZJMET-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|