C24H26N6O4 — CID 68604445
3-[6-[3-amino-4-(3-hydroxypyrrolidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide (PubChem CID 68604445) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-[6-[3-amino-4-(3-hydroxypyrrolidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide.
| Compound Name | 3-[6-[3-amino-4-(3-hydroxypyrrolidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 68604445 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 3-[6-[3-amino-4-(3-hydroxypyrrolidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylbenzamide |
| SMILES | Cc1c(C(N)=O)cccc1-c1cn(C)c(=O)c(Nc2ccc(C(=O)N3CCC(O)C3)c(N)c2)n1 |
| InChI | InChI=1S/C24H26N6O4/c1-13-16(4-3-5-17(13)21(26)32)20-12-29(2)24(34)22(28-20)27-14-6-7-18(19(25)10-14)23(33)30-9-8-15(31)11-30/h3-7,10,12,15,31H,8-9,11,25H2,1-2H3,(H2,26,32)(H,27,28) |
| InChIKey | IKZOHOFMHYQSDT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|