C22H26N6O3S — CID 143293167
3-[3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-5-(3-amino-2-methylphenyl)-1-methylpyrazin-2-one (PubChem CID 143293167) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is 3-[3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-5-(3-amino-2-methylphenyl)-1-methylpyrazin-2-one.
| Compound Name | 3-[3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-5-(3-amino-2-methylphenyl)-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 143293167 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 3-[3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-5-(3-amino-2-methylphenyl)-1-methylpyrazin-2-one |
| SMILES | Cc1c(N)cccc1-c1cn(C)c(=O)c(Nc2ccc(N3CCS(=O)(=O)CC3)c(N)c2)n1 |
| InChI | InChI=1S/C22H26N6O3S/c1-14-16(4-3-5-17(14)23)19-13-27(2)22(29)21(26-19)25-15-6-7-20(18(24)12-15)28-8-10-32(30,31)11-9-28/h3-7,12-13H,8-11,23-24H2,1-2H3,(H,25,26) |
| InChIKey | MWNRCEFIBULPRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|