C23H25N5O3 — CID 143293324
(2S)-N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]oxolane-2-carboxamide (PubChem CID 143293324) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is (2S)-N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 143293324 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | (2S)-N-[3-[[6-(3-amino-2-methylphenyl)-4-methyl-3-oxopyrazin-2-yl]amino]phenyl]oxolane-2-carboxamide |
| SMILES | Cc1c(N)cccc1-c1cn(C)c(=O)c(Nc2cccc(NC(=O)[C@@H]3CCCO3)c2)n1 |
| InChI | InChI=1S/C23H25N5O3/c1-14-17(8-4-9-18(14)24)19-13-28(2)23(30)21(27-19)25-15-6-3-7-16(12-15)26-22(29)20-10-5-11-31-20/h3-4,6-9,12-13,20H,5,10-11,24H2,1-2H3,(H,25,27)(H,26,29)/t20-/m0/s1 |
| InChIKey | XGMYUPMPBAQQHC-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|