C33H38N6O4S — CID 143293253
N-[3-[6-[3-amino-4-(4-hydroxypiperidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-2-carboxamide (PubChem CID 143293253) has the molecular formula C33H38N6O4S and a molecular weight of 614.77 g/mol. Its IUPAC name is N-[3-[6-[3-amino-4-(4-hydroxypiperidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[6-[3-amino-4-(4-hydroxypiperidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143293253 |
| Molecular Formula | C33H38N6O4S |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | N-[3-[6-[3-amino-4-(4-hydroxypiperidine-1-carbonyl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(NC(=O)C2=CC3CCCCC3S2)cccc1-c1cn(C)c(=O)c(Nc2ccc(C(=O)N3CCC(O)CC3)c(N)c2)n1 |
| InChI | InChI=1S/C33H38N6O4S/c1-19-23(7-5-8-26(19)37-31(41)29-16-20-6-3-4-9-28(20)44-29)27-18-38(2)33(43)30(36-27)35-21-10-11-24(25(34)17-21)32(42)39-14-12-22(40)13-15-39/h5,7-8,10-11,16-18,20,22,28,40H,3-4,6,9,12-15,34H2,1-2H3,(H,35,36)(H,37,41) |
| InChIKey | LGWJQSVDBGANID-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|