C23H29N7O3S — CID 175393899
4-N-[(3S)-1-cyclopropylsulfonylpyrrolidin-3-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 175393899) has the molecular formula C23H29N7O3S and a molecular weight of 483.60 g/mol. Its IUPAC name is 4-N-[(3S)-1-cyclopropylsulfonylpyrrolidin-3-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3S)-1-cyclopropylsulfonylpyrrolidin-3-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175393899 |
| Molecular Formula | C23H29N7O3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 4-N-[(3S)-1-cyclopropylsulfonylpyrrolidin-3-yl]-2-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | O=S(=O)(C1CC1)N1CC[C@H](Nc2nc(Nc3ccc(N4CCOCC4)cc3)nc3[nH]ccc23)C1 |
| InChI | InChI=1S/C23H29N7O3S/c31-34(32,19-5-6-19)30-10-8-17(15-30)25-22-20-7-9-24-21(20)27-23(28-22)26-16-1-3-18(4-2-16)29-11-13-33-14-12-29/h1-4,7,9,17,19H,5-6,8,10-15H2,(H3,24,25,26,27,28)/t17-/m0/s1 |
| InChIKey | PRKGSCGXJHXCCY-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|