C25H32N8O — CID 46927803
2-N-[2-methyl-4-[3-(4-methylpiperazin-1-yl)prop-1-ynyl]phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine (PubChem CID 46927803) has the molecular formula C25H32N8O and a molecular weight of 460.59 g/mol. Its IUPAC name is 2-N-[2-methyl-4-[3-(4-methylpiperazin-1-yl)prop-1-ynyl]phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-[2-methyl-4-[3-(4-methylpiperazin-1-yl)prop-1-ynyl]phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 46927803 |
| Molecular Formula | C25H32N8O |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-N-[2-methyl-4-[3-(4-methylpiperazin-1-yl)prop-1-ynyl]phenyl]-6-N-(oxan-4-yl)-7H-purine-2,6-diamine |
| SMILES | Cc1cc(C#CCN2CCN(C)CC2)ccc1Nc1nc(NC2CCOCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C25H32N8O/c1-18-16-19(4-3-9-33-12-10-32(2)11-13-33)5-6-21(18)29-25-30-23-22(26-17-27-23)24(31-25)28-20-7-14-34-15-8-20/h5-6,16-17,20H,7-15H2,1-2H3,(H3,26,27,28,29,30,31) |
| InChIKey | KIUWOCSMPBROAZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|