C26H30N8O — CID 46927222
4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methyl-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 46927222) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methyl-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methyl-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 46927222 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]-3-methyl-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | Cc1cc(C(=O)NCCc2ccncc2)ccc1Nc1nc(NC2CCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C26H30N8O/c1-17-15-19(25(35)28-14-11-18-9-12-27-13-10-18)7-8-21(17)32-26-33-23-22(29-16-30-23)24(34-26)31-20-5-3-2-4-6-20/h7-10,12-13,15-16,20H,2-6,11,14H2,1H3,(H,28,35)(H3,29,30,31,32,33,34) |
| InChIKey | YCFKYVJSYNQXGO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |