C30H43N7O5 — CID 134260815
7-[4-[[7-[(6-aminooxyoxan-3-yl)methyl]-6-(cyclohexylamino)purin-2-yl]amino]phenoxy]heptanoic acid (PubChem CID 134260815) has the molecular formula C30H43N7O5 and a molecular weight of 581.72 g/mol. Its IUPAC name is 7-[4-[[7-[(6-aminooxyoxan-3-yl)methyl]-6-(cyclohexylamino)purin-2-yl]amino]phenoxy]heptanoic acid.
| Compound Name | 7-[4-[[7-[(6-aminooxyoxan-3-yl)methyl]-6-(cyclohexylamino)purin-2-yl]amino]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 134260815 |
| Molecular Formula | C30H43N7O5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | 7-[4-[[7-[(6-aminooxyoxan-3-yl)methyl]-6-(cyclohexylamino)purin-2-yl]amino]phenoxy]heptanoic acid |
| SMILES | NOC1CCC(Cn2cnc3nc(Nc4ccc(OCCCCCCC(=O)O)cc4)nc(NC4CCCCC4)c32)CO1 |
| InChI | InChI=1S/C30H43N7O5/c31-42-26-16-11-21(19-41-26)18-37-20-32-28-27(37)29(33-22-8-4-3-5-9-22)36-30(35-28)34-23-12-14-24(15-13-23)40-17-7-2-1-6-10-25(38)39/h12-15,20-22,26H,1-11,16-19,31H2,(H,38,39)(H2,33,34,35,36) |
| InChIKey | HDAJKZIUDFXMFU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|