C15H16N6OS — CID 146575058
6-(4-aminoanilino)-9-(oxolan-2-yl)-1H-purine-2-thione (PubChem CID 146575058) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 6-(4-aminoanilino)-9-(oxolan-2-yl)-1H-purine-2-thione.
| Compound Name | 6-(4-aminoanilino)-9-(oxolan-2-yl)-1H-purine-2-thione |
|---|---|
| PubChem CID | 146575058 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 6-(4-aminoanilino)-9-(oxolan-2-yl)-1H-purine-2-thione |
| SMILES | Nc1ccc(Nc2[nH]c(=S)nc3c2ncn3C2CCCO2)cc1 |
| InChI | InChI=1S/C15H16N6OS/c16-9-3-5-10(6-4-9)18-13-12-14(20-15(23)19-13)21(8-17-12)11-2-1-7-22-11/h3-6,8,11H,1-2,7,16H2,(H2,18,19,20,23) |
| InChIKey | HPKGJXSQRSKUKV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|