C16H16BrN5OS — CID 146574911
6-(4-bromoanilino)-9-(oxan-2-yl)-1H-purine-2-thione (PubChem CID 146574911) has the molecular formula C16H16BrN5OS and a molecular weight of 406.31 g/mol. Its IUPAC name is 6-(4-bromoanilino)-9-(oxan-2-yl)-1H-purine-2-thione.
| Compound Name | 6-(4-bromoanilino)-9-(oxan-2-yl)-1H-purine-2-thione |
|---|---|
| PubChem CID | 146574911 |
| Molecular Formula | C16H16BrN5OS |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 6-(4-bromoanilino)-9-(oxan-2-yl)-1H-purine-2-thione |
| SMILES | S=c1nc2c(ncn2C2CCCCO2)c(Nc2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C16H16BrN5OS/c17-10-4-6-11(7-5-10)19-14-13-15(21-16(24)20-14)22(9-18-13)12-3-1-2-8-23-12/h4-7,9,12H,1-3,8H2,(H2,19,20,21,24) |
| InChIKey | WWRWMHYSGSGLBU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|