C15H15N5O2S — CID 146575202
6-(2-hydroxyanilino)-9-(oxolan-2-yl)-1H-purine-2-thione (PubChem CID 146575202) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 6-(2-hydroxyanilino)-9-(oxolan-2-yl)-1H-purine-2-thione.
| Compound Name | 6-(2-hydroxyanilino)-9-(oxolan-2-yl)-1H-purine-2-thione |
|---|---|
| PubChem CID | 146575202 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-(2-hydroxyanilino)-9-(oxolan-2-yl)-1H-purine-2-thione |
| SMILES | Oc1ccccc1Nc1[nH]c(=S)nc2c1ncn2C1CCCO1 |
| InChI | InChI=1S/C15H15N5O2S/c21-10-5-2-1-4-9(10)17-13-12-14(19-15(23)18-13)20(8-16-12)11-6-3-7-22-11/h1-2,4-5,8,11,21H,3,6-7H2,(H2,17,18,19,23) |
| InChIKey | JJHYSQWBQMQLHK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|