C15H15N5O4 — CID 146575126
6-(2,4-dihydroxyanilino)-9-(oxolan-2-yl)-1H-purin-2-one (PubChem CID 146575126) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 6-(2,4-dihydroxyanilino)-9-(oxolan-2-yl)-1H-purin-2-one.
| Compound Name | 6-(2,4-dihydroxyanilino)-9-(oxolan-2-yl)-1H-purin-2-one |
|---|---|
| PubChem CID | 146575126 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-(2,4-dihydroxyanilino)-9-(oxolan-2-yl)-1H-purin-2-one |
| SMILES | O=c1nc2c(ncn2C2CCCO2)c(Nc2ccc(O)cc2O)[nH]1 |
| InChI | InChI=1S/C15H15N5O4/c21-8-3-4-9(10(22)6-8)17-13-12-14(19-15(23)18-13)20(7-16-12)11-2-1-5-24-11/h3-4,6-7,11,21-22H,1-2,5H2,(H2,17,18,19,23) |
| InChIKey | BZXNNQLMEUORKN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|