C17H13ClFN5O — CID 151283073
N-(3-chloro-2-fluorophenyl)-9-(5-ethynyloxolan-2-yl)purin-6-amine (PubChem CID 151283073) has the molecular formula C17H13ClFN5O and a molecular weight of 357.78 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-9-(5-ethynyloxolan-2-yl)purin-6-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-9-(5-ethynyloxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 151283073 |
| Molecular Formula | C17H13ClFN5O |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-9-(5-ethynyloxolan-2-yl)purin-6-amine |
| SMILES | C#CC1CCC(n2cnc3c(Nc4cccc(Cl)c4F)ncnc32)O1 |
| InChI | InChI=1S/C17H13ClFN5O/c1-2-10-6-7-13(25-10)24-9-22-15-16(20-8-21-17(15)24)23-12-5-3-4-11(18)14(12)19/h1,3-5,8-10,13H,6-7H2,(H,20,21,23) |
| InChIKey | NYUSANRQKAWISQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|