C21H26N6O3 — CID 162735459
(1R,2S,5S,6R,7S)-6-[5-cyano-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N,9,9-trimethyl-8,10-dioxatricyclo[5.3.0.02,5]decane-2-carboxamide (PubChem CID 162735459) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-6-[5-cyano-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N,9,9-trimethyl-8,10-dioxatricyclo[5.3.0.02,5]decane-2-carboxamide.
| Compound Name | (1R,2S,5S,6R,7S)-6-[5-cyano-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N,9,9-trimethyl-8,10-dioxatricyclo[5.3.0.02,5]decane-2-carboxamide |
|---|---|
| PubChem CID | 162735459 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (1R,2S,5S,6R,7S)-6-[5-cyano-7-(ethylamino)imidazo[4,5-b]pyridin-3-yl]-N,9,9-trimethyl-8,10-dioxatricyclo[5.3.0.02,5]decane-2-carboxamide |
| SMILES | CCNc1cc(C#N)nc2c1ncn2[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@]2(C(=O)NC)CC[C@H]12 |
| InChI | InChI=1S/C21H26N6O3/c1-5-24-13-8-11(9-22)26-18-14(13)25-10-27(18)15-12-6-7-21(12,19(28)23-4)17-16(15)29-20(2,3)30-17/h8,10,12,15-17H,5-7H2,1-4H3,(H,23,28)(H,24,26)/t12-,15-,16+,17+,21+/m1/s1 |
| InChIKey | QYYZKTASUKIRIN-MXKWNSRKSA-N |
| XLogP | 1.95 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |