C27H31ClN6O5 — CID 147351966
6-[6-[(3-chlorophenyl)methylamino]-9-[(1R)-1-cyclopropyl-2,3-dihydroxy-5-(methylamino)-5-oxopentyl]purin-2-yl]hex-5-ynoic acid (PubChem CID 147351966) has the molecular formula C27H31ClN6O5 and a molecular weight of 555.04 g/mol. Its IUPAC name is 6-[6-[(3-chlorophenyl)methylamino]-9-[(1R)-1-cyclopropyl-2,3-dihydroxy-5-(methylamino)-5-oxopentyl]purin-2-yl]hex-5-ynoic acid.
| Compound Name | 6-[6-[(3-chlorophenyl)methylamino]-9-[(1R)-1-cyclopropyl-2,3-dihydroxy-5-(methylamino)-5-oxopentyl]purin-2-yl]hex-5-ynoic acid |
|---|---|
| PubChem CID | 147351966 |
| Molecular Formula | C27H31ClN6O5 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 6-[6-[(3-chlorophenyl)methylamino]-9-[(1R)-1-cyclopropyl-2,3-dihydroxy-5-(methylamino)-5-oxopentyl]purin-2-yl]hex-5-ynoic acid |
| SMILES | CNC(=O)CC(O)C(O)[C@@H](C1CC1)n1cnc2c(NCc3cccc(Cl)c3)nc(C#CCCCC(=O)O)nc21 |
| InChI | InChI=1S/C27H31ClN6O5/c1-29-21(36)13-19(35)25(39)24(17-10-11-17)34-15-31-23-26(30-14-16-6-5-7-18(28)12-16)32-20(33-27(23)34)8-3-2-4-9-22(37)38/h5-7,12,15,17,19,24-25,35,39H,2,4,9-11,13-14H2,1H3,(H,29,36)(H,37,38)(H,30,32,33)/t19?,24-,25?/m1/s1 |
| InChIKey | DFOOGCJJHGQYPN-ISISGCMPSA-N |
| XLogP | 2.51 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|