C22H30N8O3 — CID 56625240
(2R,3S,4R,5R)-2-ethynyl-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(pentan-3-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 56625240) has the molecular formula C22H30N8O3 and a molecular weight of 454.54 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-ethynyl-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(pentan-3-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-ethynyl-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(pentan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 56625240 |
| Molecular Formula | C22H30N8O3 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (2R,3S,4R,5R)-2-ethynyl-5-[2-[2-(1-methylimidazol-4-yl)ethylamino]-6-(pentan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | C#C[C@H]1O[C@@H](n2cnc3c(NC(CC)CC)nc(NCCc4cn(C)cn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H30N8O3/c1-5-13(6-2)26-19-16-20(28-22(27-19)23-9-8-14-10-29(4)11-24-14)30(12-25-16)21-18(32)17(31)15(7-3)33-21/h3,10-13,15,17-18,21,31-32H,5-6,8-9H2,1-2,4H3,(H2,23,26,27,28)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | HRVDRNPDQAOWOW-QTQZEZTPSA-N |
| XLogP | 1.07 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|