C22H26N8O6S — CID 56616293
4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(3-ethyl-1,2-oxazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 56616293) has the molecular formula C22H26N8O6S and a molecular weight of 530.57 g/mol. Its IUPAC name is 4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(3-ethyl-1,2-oxazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(3-ethyl-1,2-oxazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56616293 |
| Molecular Formula | C22H26N8O6S |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(3-ethyl-1,2-oxazol-5-yl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCc1cc([C@H]2O[C@@H](n3cnc4c(N)nc(NCCc5ccc(S(N)(=O)=O)cc5)nc43)[C@H](O)[C@@H]2O)on1 |
| InChI | InChI=1S/C22H26N8O6S/c1-2-12-9-14(36-29-12)18-16(31)17(32)21(35-18)30-10-26-15-19(23)27-22(28-20(15)30)25-8-7-11-3-5-13(6-4-11)37(24,33)34/h3-6,9-10,16-18,21,31-32H,2,7-8H2,1H3,(H2,24,33,34)(H3,23,25,27,28)/t16-,17+,18+,21+/m0/s1 |
| InChIKey | ROZAHSPPCZEHMO-XKGFGPFHSA-N |
| XLogP | 0.25 |
| TPSA | 217.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |