C21H25F3N10O4 — CID 70027650
[(2R,3R,4R,5R)-2-[6-amino-2-(2-bicyclo[2.2.1]heptanylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 70027650) has the molecular formula C21H25F3N10O4 and a molecular weight of 538.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[6-amino-2-(2-bicyclo[2.2.1]heptanylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3R,4R,5R)-2-[6-amino-2-(2-bicyclo[2.2.1]heptanylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70027650 |
| Molecular Formula | C21H25F3N10O4 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[6-amino-2-(2-bicyclo[2.2.1]heptanylamino)purin-9-yl]-5-(2-ethyltetrazol-5-yl)-4-hydroxyoxolan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CCn1nnc([C@H]2O[C@@H](n3cnc4c(N)nc(NC5CC6CCC5C6)nc43)[C@H](OC(=O)C(F)(F)F)[C@@H]2O)n1 |
| InChI | InChI=1S/C21H25F3N10O4/c1-2-34-31-16(30-32-34)13-12(35)14(38-19(36)21(22,23)24)18(37-13)33-7-26-11-15(25)28-20(29-17(11)33)27-10-6-8-3-4-9(10)5-8/h7-10,12-14,18,35H,2-6H2,1H3,(H3,25,27,28,29)/t8?,9?,10?,12-,13+,14-,18-/m1/s1 |
| InChIKey | FDDHRVYEHKDIEZ-JBNREPKTSA-N |
| XLogP | 1.12 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |