C33H33F3N12O3 — CID 66735736
[(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1H-imidazol-5-yl)ethylamino]purin-9-yl]-2-hydroxy-5-(5-methyltetrazol-2-yl)cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 66735736) has the molecular formula C33H33F3N12O3 and a molecular weight of 702.70 g/mol. Its IUPAC name is [(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1H-imidazol-5-yl)ethylamino]purin-9-yl]-2-hydroxy-5-(5-methyltetrazol-2-yl)cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1H-imidazol-5-yl)ethylamino]purin-9-yl]-2-hydroxy-5-(5-methyltetrazol-2-yl)cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66735736 |
| Molecular Formula | C33H33F3N12O3 |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | [(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1H-imidazol-5-yl)ethylamino]purin-9-yl]-2-hydroxy-5-(5-methyltetrazol-2-yl)cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1nnn([C@H]2C[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(NCCc5cnc[nH]5)nc43)[C@H](O)[C@@H]2OC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C33H33F3N12O3/c1-19-44-46-48(45-19)25-14-24(27(49)28(25)51-31(50)33(34,35)36)47-18-41-26-29(42-32(43-30(26)47)38-13-12-22-15-37-17-40-22)39-16-23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,15,17-18,23-25,27-28,49H,12-14,16H2,1H3,(H,37,40)(H2,38,39,42,43)/t24-,25+,27+,28-/m1/s1 |
| InChIKey | RDIGVHLRHQSMPP-JWNHKAHSSA-N |
| XLogP | 3.76 |
| TPSA | 186.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |