C32H36N10O4 — CID 56620933
[(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-hydroxyoxolan-3-yl] formate (PubChem CID 56620933) has the molecular formula C32H36N10O4 and a molecular weight of 624.71 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-hydroxyoxolan-3-yl] formate.
| Compound Name | [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-hydroxyoxolan-3-yl] formate |
|---|---|
| PubChem CID | 56620933 |
| Molecular Formula | C32H36N10O4 |
| Molecular Weight | 624.71 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[6-(2,2-diphenylethylamino)-2-[[(3R)-pyrrolidin-3-yl]amino]purin-9-yl]-5-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-hydroxyoxolan-3-yl] formate |
| SMILES | CCc1nc([C@H]2O[C@@H](n3cnc4c(NCC(c5ccccc5)c5ccccc5)nc(N[C@@H]5CCNC5)nc43)[C@H](OC=O)[C@@H]2O)n[nH]1 |
| InChI | InChI=1S/C32H36N10O4/c1-2-23-37-29(41-40-23)26-25(44)27(45-18-43)31(46-26)42-17-35-24-28(38-32(39-30(24)42)36-21-13-14-33-15-21)34-16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,21-22,25-27,31,33,44H,2,13-16H2,1H3,(H,37,40,41)(H2,34,36,38,39)/t21-,25-,26+,27-,31-/m1/s1 |
| InChIKey | GKPCBXWJVVIJLN-MGNILDGKSA-N |
| XLogP | 2.70 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|