C24H25N5O4 — CID 71267752
(2R,3S,5R)-2-[6-(1,2-diphenylethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 71267752) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is (2R,3S,5R)-2-[6-(1,2-diphenylethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,5R)-2-[6-(1,2-diphenylethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 71267752 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2R,3S,5R)-2-[6-(1,2-diphenylethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NC(Cc4ccccc4)c4ccccc4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C24H25N5O4/c30-12-18-20(31)21(32)24(33-18)29-14-27-19-22(25-13-26-23(19)29)28-17(16-9-5-2-6-10-16)11-15-7-3-1-4-8-15/h1-10,13-14,17-18,20-21,24,30-32H,11-12H2,(H,25,26,28)/t17?,18-,20?,21+,24-/m1/s1 |
| InChIKey | AEAJKIGHDVMXEW-QUDMNKEWSA-N |
| XLogP | 1.83 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |