C23H24N6O3 — CID 11133806
(2R,3S,4R,5R)-4-amino-5-[6-(benzhydrylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 11133806) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is (2R,3S,4R,5R)-4-amino-5-[6-(benzhydrylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-4-amino-5-[6-(benzhydrylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 11133806 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2R,3S,4R,5R)-4-amino-5-[6-(benzhydrylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(NC(c3ccccc3)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C23H24N6O3/c24-17-20(31)16(11-30)32-23(17)29-13-27-19-21(25-12-26-22(19)29)28-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,12-13,16-18,20,23,30-31H,11,24H2,(H,25,26,28)/t16-,17-,20-,23-/m1/s1 |
| InChIKey | URSNOAQMJNMWQL-FOWVLEKCSA-N |
| XLogP | 1.61 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |