C19H28N6O2 — CID 142081090
5-[6-(cyclohexylamino)-2-methylpurin-9-yl]-N-ethyloxolane-2-carboxamide (PubChem CID 142081090) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-[6-(cyclohexylamino)-2-methylpurin-9-yl]-N-ethyloxolane-2-carboxamide.
| Compound Name | 5-[6-(cyclohexylamino)-2-methylpurin-9-yl]-N-ethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 142081090 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 5-[6-(cyclohexylamino)-2-methylpurin-9-yl]-N-ethyloxolane-2-carboxamide |
| SMILES | CCNC(=O)C1CCC(n2cnc3c(NC4CCCCC4)nc(C)nc32)O1 |
| InChI | InChI=1S/C19H28N6O2/c1-3-20-19(26)14-9-10-15(27-14)25-11-21-16-17(22-12(2)23-18(16)25)24-13-7-5-4-6-8-13/h11,13-15H,3-10H2,1-2H3,(H,20,26)(H,22,23,24) |
| InChIKey | HRLGAWYJZKXYNK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |