C24H32N6O4 — CID 143134410
[4-[3-[6-amino-9-[5-(ethylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]cyclohexyl]methyl acetate (PubChem CID 143134410) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is [4-[3-[6-amino-9-[5-(ethylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]cyclohexyl]methyl acetate.
| Compound Name | [4-[3-[6-amino-9-[5-(ethylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]cyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 143134410 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [4-[3-[6-amino-9-[5-(ethylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]cyclohexyl]methyl acetate |
| SMILES | CCNC(=O)C1CCC(n2cnc3c(N)nc(C#CCC4CCC(COC(C)=O)CC4)nc32)O1 |
| InChI | InChI=1S/C24H32N6O4/c1-3-26-24(32)18-11-12-20(34-18)30-14-27-21-22(25)28-19(29-23(21)30)6-4-5-16-7-9-17(10-8-16)13-33-15(2)31/h14,16-18,20H,3,5,7-13H2,1-2H3,(H,26,32)(H2,25,28,29) |
| InChIKey | GQPGDKQGZCRCRJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|