C21H28N6O3S — CID 142971079
5-[6-amino-2-[3-(4-sulfanylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-4-hydroxyoxolane-2-carboxamide (PubChem CID 142971079) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 5-[6-amino-2-[3-(4-sulfanylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-4-hydroxyoxolane-2-carboxamide.
| Compound Name | 5-[6-amino-2-[3-(4-sulfanylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-4-hydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 142971079 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 5-[6-amino-2-[3-(4-sulfanylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyl-4-hydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)C1CC(O)C(n2cnc3c(N)nc(C#CCC4CCC(S)CC4)nc32)O1 |
| InChI | InChI=1S/C21H28N6O3S/c1-2-23-20(29)15-10-14(28)21(30-15)27-11-24-17-18(22)25-16(26-19(17)27)5-3-4-12-6-8-13(31)9-7-12/h11-15,21,28,31H,2,4,6-10H2,1H3,(H,23,29)(H2,22,25,26) |
| InChIKey | OPPCSSOWANNTGQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|