C22H29N7O3 — CID 142232067
(2S,5R)-5-[6-amino-2-[3-(4-carbamoylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyloxolane-2-carboxamide (PubChem CID 142232067) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is (2S,5R)-5-[6-amino-2-[3-(4-carbamoylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyloxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-[6-amino-2-[3-(4-carbamoylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 142232067 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (2S,5R)-5-[6-amino-2-[3-(4-carbamoylcyclohexyl)prop-1-ynyl]purin-9-yl]-N-ethyloxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CC[C@H](n2cnc3c(N)nc(C#CCC4CCC(C(N)=O)CC4)nc32)O1 |
| InChI | InChI=1S/C22H29N7O3/c1-2-25-22(31)15-10-11-17(32-15)29-12-26-18-19(23)27-16(28-21(18)29)5-3-4-13-6-8-14(9-7-13)20(24)30/h12-15,17H,2,4,6-11H2,1H3,(H2,24,30)(H,25,31)(H2,23,27,28)/t13?,14?,15-,17+/m0/s1 |
| InChIKey | OFQVEWVJRLPMCB-UMPYDWHISA-N |
| XLogP | 1.26 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|